Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | Methyl beta-Xylobioside |
|---|---|
| Synonyms | (2S,3R,4S,5R)-2-[(3R,4R,5R,6R)-4,5-Dihydroxy-6-Methoxy-Tetrahydropyran-3-Yl]Oxytetrahydropyran-3,4,5-Triol; (2S,3R,4S,5R)-2-[[(3R,4R,5R,6R)-4,5-Dihydroxy-6-Methoxy-3-Tetrahydropyranyl]Oxy]Tetrahydropyran-3,4,5-Triol; (2S,3R,4S,5R)-2-[(3R,4R,5R,6R)-4,5-Dihydroxy-6-Methoxy-Oxan-3-Yl]Oxyoxane-3,4,5-Triol |
| Molecular Structure |  |
| Molecular Formula | C11H20O9 |
| Molecular Weight | 296.27 |
| CAS Registry Number | 69973-32-6 |
| SMILES | [C@H]2(OC)[C@H](O)[C@@H](O)[C@H](O[C@H]1[C@H](O)[C@@H](O)[C@H](O)CO1)CO2 |
| InChI | 1S/C11H20O9/c1-17-10-9(16)7(14)5(3-19-10)20-11-8(15)6(13)4(12)2-18-11/h4-16H,2-3H2,1H3/t4-,5-,6+,7+,8-,9-,10-,11+/m1/s1 |
| InChIKey | RBTWYUVVELVCEW-JWJFVCDFSA-N |
| Density | 1.558g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.326°C at 760 mmHg (Cal.) |
| Flash point | 279.37°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl beta-Xylobioside |