Online Database of Chemicals from Around the World
|
CAS#: 70021-98-6 Product: 3-Nitrobenzo(a)Pyrene No suppilers available for the product. |
| Name | 3-Nitrobenzo(a)Pyrene |
|---|---|
| Synonyms | 3-Nitrobenz(A)Pyrene; 3-Nitrobenzo(A)Pyrene; Benzo(A)Pyrene, 3-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C20H11NO2 |
| Molecular Weight | 297.31 |
| CAS Registry Number | 70021-98-6 |
| SMILES | C2=CC3=CC=C4C1=CC=CC=C1C=C5C=CC(=C2[N+]([O-])=O)C3=C45 |
| InChI | 1S/C20H11NO2/c22-21(23)18-10-7-12-5-8-16-15-4-2-1-3-13(15)11-14-6-9-17(18)19(12)20(14)16/h1-11H |
| InChIKey | CQIJHYPCKYZMIV-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.546°C at 760 mmHg (Cal.) |
| Flash point | 265.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitrobenzo(a)Pyrene |