Online Database of Chemicals from Around the World
|
CAS#: 70051-25-1 Product: 2,2-Dimethoxy-1,2-diphenylethyl acetate No suppilers available for the product. |
| Name | 2,2-Dimethoxy-1,2-diphenylethyl acetate |
|---|---|
| Synonyms | 2,2-Dimethoxy-1,2-diphenylethyl acetate; NSC22516 |
| Molecular Structure |  |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 |
| CAS Registry Number | 70051-25-1 |
| EINECS | 274-290-4 |
| SMILES | O=C(OC(c1ccccc1)C(OC)(OC)c2ccccc2)C |
| InChI | 1S/C18H20O4/c1-14(19)22-17(15-10-6-4-7-11-15)18(20-2,21-3)16-12-8-5-9-13-16/h4-13,17H,1-3H3 |
| InChIKey | GZZIXSRJUBTXKJ-UHFFFAOYSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.36°C at 760 mmHg (Cal.) |
| Flash point | 173.226°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethoxy-1,2-diphenylethyl acetate |