Online Database of Chemicals from Around the World
|
CAS#: 70173-18-1 Product: 9-Hydroxyolivacine No suppilers available for the product. |
| Name | 9-Hydroxyolivacine |
|---|---|
| Synonyms | 6H-Pyrido(4,3-B)Carbazol-9-Ol, 1,5-Dimethyl-; 9-Hydroxyolivacine |
| Molecular Structure |  |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 |
| CAS Registry Number | 70173-18-1 |
| SMILES | C2=C1C(=C3C(=CC1=C(N=C2)C)C4=C([NH]3)C=CC(=C4)O)C |
| InChI | 1S/C17H14N2O/c1-9-12-5-6-18-10(2)13(12)8-15-14-7-11(20)3-4-16(14)19-17(9)15/h3-8,19-20H,1-2H3 |
| InChIKey | OYIFXXMAGOGZNO-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 556.228°C at 760 mmHg (Cal.) |
| Flash point | 290.196°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Hydroxyolivacine |