Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Methoxybenzenesulfonyl isocyanate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H7NO4S |
| Molecular Weight | 213.21 |
| CAS Registry Number | 7018-76-0 |
| SMILES | COc1ccc(cc1)S(=O)(=O)\N=C=O |
| InChI | 1S/C8H7NO4S/c1-13-7-2-4-8(5-3-7)14(11,12)9-6-10/h2-5H,1H3 |
| InChIKey | RGVBEISMHCYSNF-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.266°C at 760 mmHg (Cal.) |
| Flash point | 143.259°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxybenzenesulfonyl isocyanate |