Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(2,6-Dihydroxyphenyl)-2,2,2-trifluoroethanone |
|---|---|
| Synonyms | 1-(2,6-dihydroxyphenyl)-2,2,2-trifluoroethanone |
| Molecular Structure |  |
| Molecular Formula | C8H5F3O3 |
| Molecular Weight | 206.12 |
| CAS Registry Number | 70211-42-6 |
| SMILES | O=C(c1c(O)cccc1O)C(F)(F)F |
| InChI | 1S/C8H5F3O3/c9-8(10,11)7(14)6-4(12)2-1-3-5(6)13/h1-3,12-13H |
| InChIKey | ZHQYBVIRGLPYMR-UHFFFAOYSA-N |
| Density | 1.536g/cm3 (Cal.) |
|---|---|
| Boiling point | 240.825°C at 760 mmHg (Cal.) |
| Flash point | 99.447°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,6-Dihydroxyphenyl)-2,2,2-trifluoroethanone |