Online Database of Chemicals from Around the World
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
 |
+49 2330-8079751 | |||
 |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | 4-Ethynyl-2-nitrophenol |
|---|---|
| Synonyms | 4-ethynyl-2-nitrophenol |
| Molecular Structure |  |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 |
| CAS Registry Number | 70239-81-5 |
| SMILES | C#CC1=CC(=C(C=C1)O)[N+](=O)[O-] |
| InChI | 1S/C8H5NO3/c1-2-6-3-4-8(10)7(5-6)9(11)12/h1,3-5,10H |
| InChIKey | NGFZLEANFAKXEA-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.3±30.0°C at 760 mmHg (Cal.) |
| Flash point | 112.4±13.0°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethynyl-2-nitrophenol |