| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 1-Methyl-4-[(4-Nitrophenyl)Methyl]-Piperazine |
|---|---|
| Synonyms | 1-Methyl-4-(4-Nitrobenzyl)Piperazine-1,4-Diium; Zinc00041566 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 |
| CAS Registry Number | 70261-81-3 |
| SMILES | C2=C(C[NH+]1CC[NH+](CC1)C)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C12H17N3O2/c1-13-6-8-14(9-7-13)10-11-2-4-12(5-3-11)15(16)17/h2-5H,6-10H2,1H3/p+2 |
| InChIKey | TZZWNVPIAQKNTG-UHFFFAOYSA-P |
| Boiling point | 358.157°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 170.407°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-4-[(4-Nitrophenyl)Methyl]-Piperazine |