Online Database of Chemicals from Around the World
|
CAS#: 70319-10-7 Product: Alclofenac Epoxide No suppilers available for the product. |
| Name | Alclofenac Epoxide |
|---|---|
| Synonyms | 2-[3-Chloro-4-(2-Oxiranylmethoxy)Phenyl]Acetic Acid; 2-(3-Chloro-4-Glycidoxy-Phenyl)Acetic Acid; 2-[3-Chloro-4-(Oxiran-2-Ylmethoxy)Phenyl]Ethanoic Acid |
| Molecular Structure |  |
| Molecular Formula | C11H11ClO4 |
| Molecular Weight | 242.66 |
| CAS Registry Number | 70319-10-7 |
| SMILES | C1=C(C=CC(=C1Cl)OCC2CO2)CC(O)=O |
| InChI | 1S/C11H11ClO4/c12-9-3-7(4-11(13)14)1-2-10(9)16-6-8-5-15-8/h1-3,8H,4-6H2,(H,13,14) |
| InChIKey | FQBFPTMSLNQVNW-UHFFFAOYSA-N |
| Density | 1.402g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.191°C at 760 mmHg (Cal.) |
| Flash point | 202.482°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Alclofenac Epoxide |