Online Database of Chemicals from Around the World
|
CAS#: 70389-13-8 Product: 12,14-Dimethyl-16-Azatricyclo(9.2.2.1(4,8))Hexadeca-4,6,8(16),11,13,14-Hexaene No suppilers available for the product. |
| Name | 12,14-Dimethyl-16-Azatricyclo(9.2.2.1(4,8))Hexadeca-4,6,8(16),11,13,14-Hexaene |
|---|---|
| Synonyms | 16-Azatricyclo[9.2.2.14,8]Hexadeca-4,6,8(16),11,13,14-Hexaene,12,14-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.34 |
| CAS Registry Number | 70389-13-8 |
| SMILES | N2=C3CCC1=C(C=C(C(=C1)C)CCC2=CC=C3)C |
| InChI | 1S/C17H19N/c1-12-10-15-7-9-17-5-3-4-16(18-17)8-6-14(12)11-13(15)2/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | ZSNUUPMRSQVTLX-UHFFFAOYSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.994°C at 760 mmHg (Cal.) |
| Flash point | 148.222°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12,14-Dimethyl-16-Azatricyclo(9.2.2.1(4,8))Hexadeca-4,6,8(16),11,13,14-Hexaene |