Online Database of Chemicals from Around the World
|
CAS#: 70403-81-5 Product: 1,2,9-Trimethoxy-7-Oxoapoorphine No suppilers available for the product. |
| Name | 1,2,9-Trimethoxy-7-Oxoapoorphine |
|---|---|
| Synonyms | 1,2,9-Trimethoxyoxoaporphine; 5-21-13-00584 (Beilstein Handbook Reference); 7H-Dibenzo(De,G)Quinolin-7-One, 1,2,9-Trimethoxy- |
| Molecular Structure |  |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 |
| CAS Registry Number | 70403-81-5 |
| SMILES | C1=NC4=C2C(=C1)C=C(C(=C2C3=CC=C(C=C3C4=O)OC)OC)OC |
| InChI | 1S/C19H15NO4/c1-22-11-4-5-12-13(9-11)18(21)17-15-10(6-7-20-17)8-14(23-2)19(24-3)16(12)15/h4-9H,1-3H3 |
| InChIKey | HGJOQONKWSVYMB-UHFFFAOYSA-N |
| Density | 1.316g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.28°C at 760 mmHg (Cal.) |
| Flash point | 287.204°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,9-Trimethoxy-7-Oxoapoorphine |