|
CAS#: 705-02-2 Product: (2-Fluorophenyl)Thio]Acetic Acid No suppilers available for the product. |
| Name | (2-Fluorophenyl)Thio]Acetic Acid |
|---|---|
| Synonyms | 2-[(2-Fluorophenyl)Thio]Acetate; 2-(2-Fluorophenyl)Sulfanylethanoate; Zinc00109210 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6FO2S |
| Molecular Weight | 185.19 |
| CAS Registry Number | 705-02-2 |
| SMILES | C1=C(SCC([O-])=O)C(=CC=C1)F |
| InChI | 1S/C8H7FO2S/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| InChIKey | BSTQAHSCLFITHV-UHFFFAOYSA-M |
| Boiling point | 297.559°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 133.759°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2-Fluorophenyl)Thio]Acetic Acid |