Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,2-Diethyl-2-methyl-5,7-indolinediamine |
|---|---|
| Synonyms | 1,2-diethyl-2-methylindoline-5,7-diamine |
| Molecular Structure |  |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 |
| CAS Registry Number | 705928-06-9 |
| SMILES | CCC1(Cc2cc(cc(c2N1CC)N)N)C |
| InChI | 1S/C13H21N3/c1-4-13(3)8-9-6-10(14)7-11(15)12(9)16(13)5-2/h6-7H,4-5,8,14-15H2,1-3H3 |
| InChIKey | MRSYGYVACOCBIQ-UHFFFAOYSA-N |
| Density | 1.056g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.411°C at 760 mmHg (Cal.) |
| Flash point | 198.864°C (Cal.) |
| Refractive index | 1.58 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Diethyl-2-methyl-5,7-indolinediamine |