| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2-[(2,2,3,3,3-Pentafluoropropoxy)methyl]oxirane |
|---|---|
| Synonyms | 2-(2,2,3,3,3-Pentafluoropropoxymethyl)oxirane; 2,2,3,3,3-pentafluoro-1-(oxiran-2-ylmethoxy)propane; 2,2,3,3,3-Pentafluoropropoxymethyloxirane |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7F5O2 |
| Molecular Weight | 206.11 |
| CAS Registry Number | 706-89-8 |
| SMILES | C1C(O1)COCC(C(F)(F)F)(F)F |
| InChI | 1S/C6H7F5O2/c7-5(8,6(9,10)11)3-12-1-4-2-13-4/h4H,1-3H2 |
| InChIKey | ABTNQISXTOWQTC-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| 1.3534 (Expl.) | |
| Boiling point | 138.027°C at 760 mmHg (Cal.) |
| 144.5-144.7°C (Expl.) | |
| Flash point | 43.106°C (Cal.) |
| Refractive index | 1.3419 (Expl.) |
| Safety Description | Irritant |
|---|---|
| R10,R36/37/38 | |
| S16,S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-[(2,2,3,3,3-Pentafluoropropoxy)methyl]oxirane |