Online Database of Chemicals from Around the World
|
CAS#: 70715-02-5 Product: Phosphoric acid (hydroxy-methoxy-phosphoryl) dimethyl ester No suppilers available for the product. |
| Name | Phosphoric acid (hydroxy-methoxy-phosphoryl) dimethyl ester |
|---|---|
| Synonyms | (Hydroxy-Methoxy-Phosphoryl) Dimethyl Phosphate; Phosphoric Acid (Hydroxy-Methoxyphosphoryl) Dimethyl Ester; Phosphoric Acid (Hydroxy-Methoxy-Phosphoryl) Dimethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C3H10O7P2 |
| Molecular Weight | 220.06 |
| CAS Registry Number | 70715-02-5 |
| SMILES | CO[P](=O)(O)O[P](=O)(OC)OC |
| InChI | 1S/C3H10O7P2/c1-7-11(4,5)10-12(6,8-2)9-3/h1-3H3,(H,4,5) |
| InChIKey | KTOCGRDHTCKGRC-UHFFFAOYSA-N |
| Density | 1.474g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.319°C at 760 mmHg (Cal.) |
| Flash point | 110.028°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphoric acid (hydroxy-methoxy-phosphoryl) dimethyl ester |