Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,4-Dihydrocyclopenta[b]indole |
|---|---|
| Synonyms | 3,4-dihydrocyclopenta[b]indole |
| Molecular Structure | ![CAS#: 7075-77-6， 3,4-Dihydrocyclopenta[b]indole](/moreStructures/7075-77-6.gif) |
| Molecular Formula | C11H9N |
| Molecular Weight | 155.20 |
| CAS Registry Number | 7075-77-6 |
| SMILES | c1ccc2c(c1)c3c([nH]2)CC=C3 |
| InChI | 1S/C11H9N/c1-2-6-10-8(4-1)9-5-3-7-11(9)12-10/h1-6,12H,7H2 |
| InChIKey | VEOOYKXXDYLCBG-UHFFFAOYSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.324°C at 760 mmHg (Cal.) |
| Flash point | 145.613°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydrocyclopenta[b]indole |