Online Database of Chemicals from Around the World
|
CAS#: 70751-94-9 Product: 5-Isothiocyanato-2-methoxy-N,N,3-trimethylbenzamide No suppilers available for the product. |
| Name | 5-Isothiocyanato-2-methoxy-N,N,3-trimethylbenzamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 |
| CAS Registry Number | 70751-94-9 |
| SMILES | Cc1cc(cc(C(=O)N(C)C)c1OC)/N=C=S |
| InChI | 1S/C12H14N2O2S/c1-8-5-9(13-7-17)6-10(11(8)16-4)12(15)14(2)3/h5-6H,1-4H3 |
| InChIKey | SJDGOKGRYGWNTC-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.998°C at 760 mmHg (Cal.) |
| Flash point | 220.508°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Isothiocyanato-2-methoxy-N,N,3-trimethylbenzamide |