|
CAS#: 70794-01-3 Product: 8-Methyl-2-phenyl-4H-chromen-4-one No suppilers available for the product. |
| Name | 8-Methyl-2-phenyl-4H-chromen-4-one |
|---|---|
| Synonyms | 8-methyl-2-phenylchromen-4-one; 8-Methyl-2-phenyl-chromen-4-one; ZINC00038943 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 70794-01-3 |
| SMILES | CC1=C2C(=CC=C1)C(=O)C=C(O2)C3=CC=CC=C3 |
| InChI | 1S/C16H12O2/c1-11-6-5-9-13-14(17)10-15(18-16(11)13)12-7-3-2-4-8-12/h2-10H,1H3 |
| InChIKey | JTTIFEIDOQSMRZ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.9±42.0°C at 760 mmHg (Cal.) |
| Flash point | 182.8±21.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Methyl-2-phenyl-4H-chromen-4-one |