Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 5-oxo-2-vinyl-L-prolinate |
|---|---|
| Synonyms | (R)-methyl 5-oxo-2-vinylpyrrolidine-2-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 |
| CAS Registry Number | 70805-06-0 |
| SMILES | COC(=O)[C@@]1(CCC(=O)N1)C=C |
| InChI | 1S/C8H11NO3/c1-3-8(7(11)12-2)5-4-6(10)9-8/h3H,1,4-5H2,2H3,(H,9,10)/t8-/m0/s1 |
| InChIKey | VLHMSEYIPSXDGQ-QMMMGPOBSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.909°C at 760 mmHg (Cal.) |
| Flash point | 136.995°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 5-oxo-2-vinyl-L-prolinate |