Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Allyl-1-(4-ethoxyphenyl)urea |
|---|---|
| Synonyms | 1-allyl-1-(4-ethoxyphenyl)urea |
| Molecular Structure |  |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 708236-77-5 |
| SMILES | CCOc1ccc(cc1)N(CC=C)C(=O)N |
| InChI | 1S/C12H16N2O2/c1-3-9-14(12(13)15)10-5-7-11(8-6-10)16-4-2/h3,5-8H,1,4,9H2,2H3,(H2,13,15) |
| InChIKey | QIPCZCVMCITVLQ-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.38°C at 760 mmHg (Cal.) |
| Flash point | 172.962°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Allyl-1-(4-ethoxyphenyl)urea |