Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-Acetylbenzenesulfonyl Fluoride |
|---|---|
| Synonyms | 3-Ethanoylbenzenesulfonyl Fluoride; 3-Acetylbenzenesulphonyl Fluoride; Acetylbenzenesulfonyl Fluoride |
| Molecular Structure |  |
| Molecular Formula | C8H7FO3S |
| Molecular Weight | 202.20 |
| CAS Registry Number | 709-60-4 |
| EINECS | 211-912-5 |
| SMILES | C1=C(C=CC=C1C(C)=O)[S](=O)(=O)F |
| InChI | 1S/C8H7FO3S/c1-6(10)7-3-2-4-8(5-7)13(9,11)12/h2-5H,1H3 |
| InChIKey | NEVFJPDNDDMQGD-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.588°C at 760 mmHg (Cal.) |
| Flash point | 138.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Acetylbenzenesulfonyl Fluoride |