Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Ethyl 4'-formyl-4-biphenylcarboxylate |
|---|---|
| Synonyms | 4-Formylbiphenyl-4-carboxylicacidethylester |
| Molecular Structure |  |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 |
| CAS Registry Number | 70917-02-1 |
| SMILES | O=Cc1ccc(cc1)c2ccc(cc2)C(=O)OCC |
| InChI | 1S/C16H14O3/c1-2-19-16(18)15-9-7-14(8-10-15)13-5-3-12(11-17)4-6-13/h3-11H,2H2,1H3 |
| InChIKey | GGDSRNHFXHUEHE-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.474°C at 760 mmHg (Cal.) |
| Flash point | 182.159°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4'-formyl-4-biphenylcarboxylate |