| Guangzhou Lanning Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.lanningbio.net | |||
![]() | +86 15813355568 | |||
![]() | lanningsale@sina.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 15813355568 | |||
![]() | WhatsApp:+8615813355568 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | Mupirocin EP Impurity E |
|---|---|
| Synonyms | 9-(((2E)-4-((2R,3RS,4aS,7S,8S,8aR)-3,8-Dihydroxy-2-((1S,2S)-2-hydroxy-1-methylpropyl)hexahydro-2H,5H-pyrano(4,3-b)pyran-7-yl)-3-methylbut-2-enoyl)oxy)nonanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C26H44O9 |
| Molecular Weight | 500.62 |
| CAS Registry Number | 71087-96-2 |
| SMILES | C[C@H]([C@@H]1C(C[C@H]2CO[C@H]([C@@H]([C@@H]2O1)O)C/C(=C/C(=O)OCCCCCCCCC(=O)O)/C)O)[C@H](C)O |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.517, Calc.* |
| Boiling Point | 691.7±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 223.8±25.0 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Mupirocin EP Impurity E |