|
CAS#: 71100-56-6 Product: 1-[(4-Methylphenyl)sulfonyl]-4-nitro-1H-imidazole No suppilers available for the product. |
| Name | 1-[(4-Methylphenyl)sulfonyl]-4-nitro-1H-imidazole |
|---|---|
| Synonyms | 1-(TOLUENE-4-SULFONYL)-4-NITROIMIDAZOLE; 1-[(4-methylbenzene)sulfonyl]-4-nitro-1H-imidazole |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.26 |
| CAS Registry Number | 71100-56-6 |
| SMILES | O=[N+]([O-])c1ncn(c1)S(=O)(=O)c2ccc(cc2)C |
| InChI | 1S/C10H9N3O4S/c1-8-2-4-9(5-3-8)18(16,17)12-6-10(11-7-12)13(14)15/h2-7H,1H3 |
| InChIKey | PDGRCWHRWSOPKZ-UHFFFAOYSA-N |
| Density | 1.511g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.067°C at 760 mmHg (Cal.) |
| Flash point | 252.603°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(4-Methylphenyl)sulfonyl]-4-nitro-1H-imidazole |