Online Database of Chemicals from Around the World
|
CAS#: 7114-11-6 Product: Naphthonone No suppilers available for the product. |
| Name | Naphthonone |
|---|---|
| Synonyms | 2-(2-Hydroxy-1-Naphthyl)Cyclohexan-1-One; 2-(2-Hydroxy-1-Naphthyl)-1-Cyclohexanone; 2-(2-Hydroxynaphth-1-Yl)Cyclohexanone |
| Molecular Structure |  |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 7114-11-6 |
| EINECS | 230-417-5 |
| SMILES | C2=C1C(=C(C=CC1=CC=C2)O)C3C(CCCC3)=O |
| InChI | 1S/C16H16O2/c17-14-8-4-3-7-13(14)16-12-6-2-1-5-11(12)9-10-15(16)18/h1-2,5-6,9-10,13,18H,3-4,7-8H2 |
| InChIKey | FQCYCLSYFLSHKF-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.598°C at 760 mmHg (Cal.) |
| Flash point | 165.512°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphthonone |