Online Database of Chemicals from Around the World
|
CAS#: 71172-13-9 Product: 10-Fluoro-7,12-Dimethylbenz(a)Anthracene No suppilers available for the product. |
| Name | 10-Fluoro-7,12-Dimethylbenz(a)Anthracene |
|---|---|
| Synonyms | 10-Fluoro-7,12-Dimethyl-Benzo[B]Phenanthrene; 10-Fluoro-7,12-Dimethylbenz(A)Anthracene; 7,12-Dimethyl-10-Fluorobenz(A)Anthracene |
| Molecular Structure |  |
| Molecular Formula | C20H15F |
| Molecular Weight | 274.34 |
| CAS Registry Number | 71172-13-9 |
| SMILES | C1=C4C(=C2C(=C1)C=CC=C2)C(=C3C=C(F)C=CC3=C4C)C |
| InChI | 1S/C20H15F/c1-12-16-10-8-15(21)11-19(16)13(2)20-17(12)9-7-14-5-3-4-6-18(14)20/h3-11H,1-2H3 |
| InChIKey | LSMDFKIGMKDUOJ-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.357°C at 760 mmHg (Cal.) |
| Flash point | 213.257°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Fluoro-7,12-Dimethylbenz(a)Anthracene |