|
CAS#: 71172-46-8 Product: alpha-Methyl-alpha-(1-Methylcyclopropyl)Benzyl Alcohol No suppilers available for the product. |
| Name | alpha-Methyl-alpha-(1-Methylcyclopropyl)Benzyl Alcohol |
|---|---|
| Synonyms | 1-(1-Methylcyclopropyl)-1-Phenyl-Ethanol; St5443678 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 |
| CAS Registry Number | 71172-46-8 |
| EINECS | 275-232-0 |
| SMILES | C2=C(C(C1(CC1)C)(C)O)C=CC=C2 |
| InChI | 1S/C12H16O/c1-11(8-9-11)12(2,13)10-6-4-3-5-7-10/h3-7,13H,8-9H2,1-2H3 |
| InChIKey | JKVXNQHAQDPGRQ-UHFFFAOYSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.181°C at 760 mmHg (Cal.) |
| Flash point | 110.778°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for alpha-Methyl-alpha-(1-Methylcyclopropyl)Benzyl Alcohol |