Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-Ethyl-N-(p-Tolyl)-Acetamide |
|---|---|
| Synonyms | N-Ethylsulfonyl-N-(4-Methylphenyl)Ethanamide; Acetamide, N-Ethyl-N-(P-Tolylsulfonyl)-; Acetamide, N-Ethyl-N-(P-Tolyl)- |
| Molecular Structure |  |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.30 |
| CAS Registry Number | 71173-13-2 |
| SMILES | C1=C(C=CC(=C1)N(C(C)=O)[S](=O)(=O)CC)C |
| InChI | 1S/C11H15NO3S/c1-4-16(14,15)12(10(3)13)11-7-5-9(2)6-8-11/h5-8H,4H2,1-3H3 |
| InChIKey | IUTIXSIPOCWLIJ-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.156°C at 760 mmHg (Cal.) |
| Flash point | 181.293°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-N-(p-Tolyl)-Acetamide |