Online Database of Chemicals from Around the World
|
CAS#: 71173-51-8 Product: 1a-Methyl-1a,2,2a,8a,9,9a-hexahydroanthra[2,3-b]oxirene-3,8-dione No suppilers available for the product. |
| Name | 1a-Methyl-1a,2,2a,8a,9,9a-hexahydroanthra[2,3-b]oxirene-3,8-dione |
|---|---|
| Molecular Structure | ![CAS#: 71173-51-8， 1a-Methyl-1a,2,2a,8a,9,9a-hexahydroanthra[2,3-b]oxirene-3,8-dione](/moreStructures/71173-51-8.gif) |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 71173-51-8 |
| SMILES | CC12CC3C(CC1O2)C(=O)c4ccccc4C3=O |
| InChI | 1S/C15H14O3/c1-15-7-11-10(6-12(15)18-15)13(16)8-4-2-3-5-9(8)14(11)17/h2-5,10-12H,6-7H2,1H3 |
| InChIKey | MFABPXKHKBXOAA-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.184°C at 760 mmHg (Cal.) |
| Flash point | 185.555°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1a-Methyl-1a,2,2a,8a,9,9a-hexahydroanthra[2,3-b]oxirene-3,8-dione |