|
CAS#: 71173-78-9 Product: 1-Chloro-2-Isopropyliminomethyl-4-Nitrobenzene No suppilers available for the product. |
| Name | 1-Chloro-2-Isopropyliminomethyl-4-Nitrobenzene |
|---|---|
| Synonyms | 1-(2-Chloro-5-Nitro-Phenyl)-N-Isopropyl-Methanimine; 1-(2-Chloro-5-Nitrophenyl)-N-Isopropylmethanimine; (2-Chloro-5-Nitro-Benzylidene)-Isopropyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 |
| CAS Registry Number | 71173-78-9 |
| SMILES | C1=C(C(=CC=C1[N+](=O)[O-])Cl)C=NC(C)C |
| InChI | 1S/C10H11ClN2O2/c1-7(2)12-6-8-5-9(13(14)15)3-4-10(8)11/h3-7H,1-2H3 |
| InChIKey | ROZKXRIKKOBONW-UHFFFAOYSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.091°C at 760 mmHg (Cal.) |
| Flash point | 152.224°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-2-Isopropyliminomethyl-4-Nitrobenzene |