Online Database of Chemicals from Around the World
| Name | 1-Methoxymethyl-4-Methylnaphthalene |
|---|---|
| Synonyms | 1-(Methoxymethyl)-4-Methyl-Naphthalene; 1-Methoxymethyl-4-Methylnaphthalene |
| Molecular Structure |  |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 |
| CAS Registry Number | 71235-76-2 |
| EINECS | 275-280-2 |
| SMILES | C1=C(C2=C(C(=C1)C)C=CC=C2)COC |
| InChI | 1S/C13H14O/c1-10-7-8-11(9-14-2)13-6-4-3-5-12(10)13/h3-8H,9H2,1-2H3 |
| InChIKey | CDZSYRIMGYFGKR-UHFFFAOYSA-N |
| Density | 1.04g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.201°C at 760 mmHg (Cal.) |
| Flash point | 135.842°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxymethyl-4-Methylnaphthalene |
