| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | (+)-p-Bromotetramisole Oxalate |
|---|---|
| Synonyms | (6R)-6-(4-Bromophenyl)-2,3,5,6-Tetrahydroimidazo[2,1-B]Thiazole; Zinc00056496 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 |
| CAS Registry Number | 71461-24-0 |
| EINECS | 275-471-0 |
| SMILES | [C@H]2(CN1CCSC1=N2)C3=CC=C(C=C3)Br |
| InChI | 1S/C11H11BrN2S/c12-9-3-1-8(2-4-9)10-7-14-5-6-15-11(14)13-10/h1-4,10H,5-7H2/t10-/m0/s1 |
| InChIKey | HTHGAIADRJRJOY-JTQLQIEISA-N |
| Density | 1.699g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.576°C at 760 mmHg (Cal.) |
| Flash point | 188.804°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+)-p-Bromotetramisole Oxalate |