Online Database of Chemicals from Around the World
|
CAS#: 71501-11-6 Product: 4'-Bromo-4-(4-Bromophenyl)Butyrophenone No suppilers available for the product. |
| Name | 4'-Bromo-4-(4-Bromophenyl)Butyrophenone |
|---|---|
| Synonyms | 4'-Bromo-4-(4-Bromophenyl)Butyrophenone |
| Molecular Structure |  |
| Molecular Formula | C16H14Br2O |
| Molecular Weight | 382.09 |
| CAS Registry Number | 71501-11-6 |
| EINECS | 275-543-1 |
| SMILES | C1=C(Br)C=CC(=C1)C(=O)CCCC2=CC=C(Br)C=C2 |
| InChI | 1S/C16H14Br2O/c17-14-8-4-12(5-9-14)2-1-3-16(19)13-6-10-15(18)11-7-13/h4-11H,1-3H2 |
| InChIKey | XWLXFOHOTCVERQ-UHFFFAOYSA-N |
| Density | 1.547g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.941°C at 760 mmHg (Cal.) |
| Flash point | 119.888°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Bromo-4-(4-Bromophenyl)Butyrophenone |