Online Database of Chemicals from Around the World
|
CAS#: 7152-44-5 Product: Ethylsulfanyl-(4-Ethylsulfonylphenyl)Methanone No suppilers available for the product. |
| Name | Ethylsulfanyl-(4-Ethylsulfonylphenyl)Methanone |
|---|---|
| Synonyms | 4-Ethylsulfonylbenzenecarbothioic Acid S-Ethyl Ester; 4-Ethylsulfonylthiobenzoic Acid S-Ethyl Ester; Nsc23808 |
| Molecular Structure |  |
| Molecular Formula | C11H14O3S2 |
| Molecular Weight | 258.35 |
| CAS Registry Number | 7152-44-5 |
| SMILES | C1=C(C(SCC)=O)C=CC(=C1)[S](=O)(CC)=O |
| InChI | 1S/C11H14O3S2/c1-3-15-11(12)9-5-7-10(8-6-9)16(13,14)4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | SAXKFUJMKXSQDT-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.787°C at 760 mmHg (Cal.) |
| Flash point | 207.68°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylsulfanyl-(4-Ethylsulfonylphenyl)Methanone |