|
CAS#: 71605-84-0 Product: 3,7-Dimethyl-2,6-octadien-1-yl 3-phenylacrylate No suppilers available for the product. |
| Name | 3,7-Dimethyl-2,6-octadien-1-yl 3-phenylacrylate |
|---|---|
| Synonyms | KBio3_002139; KBioGR_002549; SPBio_002129 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.39 |
| CAS Registry Number | 71605-84-0 |
| EINECS | 275-663-4 |
| SMILES | O=C(OCC=C(C)CC\C=C(/C)C)C=Cc1ccccc1 |
| InChI | 1S/C19H24O2/c1-16(2)8-7-9-17(3)14-15-21-19(20)13-12-18-10-5-4-6-11-18/h4-6,8,10-14H,7,9,15H2,1-3H3 |
| InChIKey | JCWXWRIQSPDSKY-UHFFFAOYSA-N |
| Density | 0.995g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.702°C at 760 mmHg (Cal.) |
| Flash point | 228.752°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dimethyl-2,6-octadien-1-yl 3-phenylacrylate |