Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-Hydroxypropyl Salicylate |
|---|---|
| Synonyms | 2-Hydroxybenzoic Acid 2-Hydroxypropyl Ester; Salicylsaeure-2-Hydroxypropylester; St5445239 |
| Molecular Structure |  |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 |
| CAS Registry Number | 71672-82-7 |
| EINECS | 275-818-6 |
| SMILES | C1=C(C(OCC(C)O)=O)C(=CC=C1)O |
| InChI | 1S/C10H12O4/c1-7(11)6-14-10(13)8-4-2-3-5-9(8)12/h2-5,7,11-12H,6H2,1H3 |
| InChIKey | CEGJMSLTYGORDN-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.836°C at 760 mmHg (Cal.) |
| Flash point | 126.11°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxypropyl Salicylate |