Online Database of Chemicals from Around the World
|
CAS#: 7168-99-2 Product: 4,6-Dimethoxyisophthalic acid No suppilers available for the product. |
| Name | 4,6-Dimethoxyisophthalic acid |
|---|---|
| Synonyms | 4,6-dimethoxy-isophthalic acid |
| Molecular Structure |  |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 |
| CAS Registry Number | 7168-99-2 |
| SMILES | COc1cc(OC)c(cc1C(O)=O)C(O)=O |
| InChI | 1S/C10H10O6/c1-15-7-4-8(16-2)6(10(13)14)3-5(7)9(11)12/h3-4H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | SSKJKUWEVZTCMC-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.893°C at 760 mmHg (Cal.) |
| Flash point | 167.006°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethoxyisophthalic acid |