Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(2,4-Dichlorophenyl)-2-hydroxyacetamide |
|---|---|
| Synonyms | 2-(2,4-dichlorophenyl)-2-hydroxyacetamide |
| Molecular Structure |  |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.05 |
| CAS Registry Number | 71715-65-6 |
| SMILES | c1cc(c(cc1Cl)Cl)C(C(=O)N)O |
| InChI | 1S/C8H7Cl2NO2/c9-4-1-2-5(6(10)3-4)7(12)8(11)13/h1-3,7,12H,(H2,11,13) |
| InChIKey | CWPBBNPVHMZOCU-UHFFFAOYSA-N |
| Density | 1.515g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.218°C at 760 mmHg (Cal.) |
| Flash point | 200.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4-Dichlorophenyl)-2-hydroxyacetamide |