| Creative Peptides | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 624-4882 | |||
![]() |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Alanine derivatives |
|---|---|
| Name | Z-Phe-Ala-Diazomethylketone |
| Synonyms | (3S)-1-Diazonio-3-[[(2S)-3-Phenyl-2-(Phenylmethoxycarbonylamino)Propanoyl]Amino]But-1-En-2-Olate; (Z,3S)-1-Diazonio-3-[[(2S)-1-Oxo-2-[[Oxo-(Phenylmethoxy)Methyl]Amino]-3-Phenylpropyl]Amino]But-1-En-2-Olate; (3S)-1-Diazonio-3-[[(2S)-1-Oxo-2-[[Oxo-(Phenylmethoxy)Methyl]Amino]-3-Phenylpropyl]Amino]But-1-En-2-Olate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 |
| CAS Registry Number | 71732-53-1 |
| SMILES | [N+](=[N-])=CC(=O)[C@@H](NC(=O)[C@@H](NC(OCC1=CC=CC=C1)=O)CC2=CC=CC=C2)C |
| InChI | 1S/C21H22N4O4/c1-15(19(26)13-23-22)24-20(27)18(12-16-8-4-2-5-9-16)25-21(28)29-14-17-10-6-3-7-11-17/h2-11,13,15,18H,12,14H2,1H3,(H,24,27)(H,25,28)/t15-,18-/m0/s1 |
| InChIKey | QMPATRQNERZOMF-YJBOKZPZSA-N |
| Protein Sequence | Z-Phe-Ala-diazomethylketone |
| Market Analysis Reports |
| List of Reports Available for Z-Phe-Ala-Diazomethylketone |