Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Dr. Silviu Pharmachem Pvt. Ltd | India | Inquire | ||
|---|---|---|---|---|
|
+91 (20) 6510-4672 | |||
|
anil.bhise@silviupharmachem.com | |||
| Chemical manufacturer | ||||
| Name | 5-Quinoxalinecarbonyl chloride |
|---|---|
| Synonyms | 5-QUINOXALINECARBONYLCHLORIDE; quinoxaline-5-carbonyl chloride |
| Molecular Structure |  |
| Molecular Formula | C9H5ClN2O |
| Molecular Weight | 192.60 |
| CAS Registry Number | 717871-86-8 |
| SMILES | c1cc(c2c(c1)nccn2)C(=O)Cl |
| InChI | 1S/C9H5ClN2O/c10-9(13)6-2-1-3-7-8(6)12-5-4-11-7/h1-5H |
| InChIKey | JFLVZLAMKBYZHW-UHFFFAOYSA-N |
| Density | 1.412g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.38°C at 760 mmHg (Cal.) |
| Flash point | 149.98°C (Cal.) |
| Refractive index | 1.663 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Quinoxalinecarbonyl chloride |