Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (3,5-Dimethyl-4-Isoxazolyl)[4-(2-Ethoxyphenyl)-1-Piperazinyl]-Methanone |
|---|---|
| Synonyms | Methanone, (3,5-Dimethyl-4-Isoxazolyl)[4-(2-Ethoxyphenyl)-1-Piperazinyl]- |
| Molecular Structure | ![CAS#: 717872-74-7， (3,5-Dimethyl-4-Isoxazolyl)[4-(2-Ethoxyphenyl)-1-Piperazinyl]-Methanone](/moreStructures/717872-74-7.gif) |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.39 |
| CAS Registry Number | 717872-74-7 |
| SMILES | CCOc1ccccc1N1CCN(CC1)C(=O)c1c(C)noc1C |
| InChI | 1S/C18H23N3O3/c1-4-23-16-8-6-5-7-15(16)20-9-11-21(12-10-20)18(22)17-13(2)19-24-14(17)3/h5-8H,4,9-12H2,1-3H3 |
| Market Analysis Reports |
| List of Reports Available for (3,5-Dimethyl-4-Isoxazolyl)[4-(2-Ethoxyphenyl)-1-Piperazinyl]-Methanone |