Online Database of Chemicals from Around the World
| Name | 1-[4-(4-Methylphenoxy)phenyl]ethanone |
|---|---|
| Synonyms | 1-(4-(p-Tolyloxy)phenyl)ethanone |
| Molecular Structure | ![CAS#: 71815-31-1， 1-[4-(4-Methylphenoxy)phenyl]ethanone](/moreStructures/71815-31-1.gif) |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 |
| CAS Registry Number | 71815-31-1 |
| SMILES | O=C(c2ccc(Oc1ccc(cc1)C)cc2)C |
| InChI | 1S/C15H14O2/c1-11-3-7-14(8-4-11)17-15-9-5-13(6-10-15)12(2)16/h3-10H,1-2H3 |
| InChIKey | CAZWIMGCKKDNSZ-UHFFFAOYSA-N |
| Density | 1.089g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.575°C at 760 mmHg (Cal.) |
| Flash point | 152.171°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-[4-(4-Methylphenoxy)phenyl]ethanone |
