Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Dimethyl (2R,3R)-2,3-difluorosuccinate |
|---|---|
| Synonyms | (2R,3R)-dimethyl 2,3-difluorosuccinate |
| Molecular Structure |  |
| Molecular Formula | C6H8F2O4 |
| Molecular Weight | 182.12 |
| CAS Registry Number | 71974-84-0 |
| SMILES | COC(=O)[C@H]([C@@H](C(=O)OC)F)F |
| InChI | 1S/C6H8F2O4/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4H,1-2H3/t3-,4-/m0/s1 |
| InChIKey | HTCDJPGLTNCTGT-IMJSIDKUSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 208.2±35.0°C at 760 mmHg (Cal.) |
| Flash point | 77.7±20.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl (2R,3R)-2,3-difluorosuccinate |