|
CAS#: 71993-15-2 Product: 1-(4-Amino-2-Methylquinolin-3-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(4-Amino-2-Methylquinolin-3-Yl)Ethanone |
|---|---|
| Synonyms | 1-(4-Amino-2-Methyl-Quinolin-1-Ium-3-Yl)Ethanone; 1-(4-Amino-2-Methyl-3-Quinolin-1-Iumyl)Ethanone; Zinc00033978 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13N2O |
| Molecular Weight | 201.25 |
| CAS Registry Number | 71993-15-2 |
| SMILES | C2=C1C(=C(C(=[NH+]C1=CC=C2)C)C(=O)C)N |
| InChI | 1S/C12H12N2O/c1-7-11(8(2)15)12(13)9-5-3-4-6-10(9)14-7/h3-6H,1-2H3,(H2,13,14)/p+1 |
| InChIKey | YFGFFNPPTDOYLI-UHFFFAOYSA-O |
| Boiling point | 369.347°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 177.175°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Amino-2-Methylquinolin-3-Yl)Ethanone |