Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 11-Dehydrocorticosterone |
|---|---|
| Synonyms | 17-(2-Hydroxy-1-Oxoethyl)-10,13-Dimethyl-2,6,7,8,9,12,14,15,16,17-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,11-Dione; 17-Glycoloyl-10,13-Dimethyl-2,6,7,8,9,12,14,15,16,17-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,11-Quinone; 17-(2-Hydroxyethanoyl)-10,13-Dimethyl-2,6,7,8,9,12,14,15,16,17-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,11-Dione |
| Molecular Structure |  |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 |
| CAS Registry Number | 72-23-1 |
| EINECS | 200-776-2 |
| SMILES | C(C(C4C3(C(C2C(C1(C(=CC(=O)CC1)CC2)C)C(C3)=O)CC4)C)=O)O |
| InChI | 1S/C21H28O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-16,19,22H,3-8,10-11H2,1-2H3 |
| InChIKey | FUFLCEKSBBHCMO-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.024°C at 760 mmHg (Cal.) |
| Flash point | 288.423°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Dehydrocorticosterone |