Online Database of Chemicals from Around the World
|
CAS#: 720-49-0 Product: 6-(Trifluoromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide No suppilers available for the product. |
| Name | 6-(Trifluoromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| Synonyms | 6-(Trifluoromethyl)-3,4-Dihydro-2H-1,2,4-Benzothiadiazine 1,1-Dioxide; Aids-124732; Aids124732 |
| Molecular Structure |  |
| Molecular Formula | C8H7F3N2O2S |
| Molecular Weight | 252.21 |
| CAS Registry Number | 720-49-0 |
| SMILES | C1=CC(=CC2=C1[S](NCN2)(=O)=O)C(F)(F)F |
| InChI | 1S/C8H7F3N2O2S/c9-8(10,11)5-1-2-7-6(3-5)12-4-13-16(7,14)15/h1-3,12-13H,4H2 |
| InChIKey | DPJZVOYJEZTZKG-UHFFFAOYSA-N |
| Density | 1.498g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.197°C at 760 mmHg (Cal.) |
| Flash point | 165.593°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(Trifluoromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide |