Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-[(2,5-Dimethoxyphenyl)Methyl]Propanedioic Acid |
|---|---|
| Synonyms | 2-(2,5-Dimethoxybenzyl)Malonic Acid; Propanedioic Acid, ((2,5-Dimethoxyphenyl)Methyl)-; ((2,5-Dimethoxyphenyl)Methyl)Propanedioic Acid |
| Molecular Structure | ![CAS#: 72018-08-7， 2-[(2,5-Dimethoxyphenyl)Methyl]Propanedioic Acid](/moreStructures/72018-08-7.gif) |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 |
| CAS Registry Number | 72018-08-7 |
| SMILES | C1=C(C=C(C(=C1)OC)CC(C(=O)O)C(=O)O)OC |
| InChI | 1S/C12H14O6/c1-17-8-3-4-10(18-2)7(5-8)6-9(11(13)14)12(15)16/h3-5,9H,6H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | HSUUQNZJIBIZOS-UHFFFAOYSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.038°C at 760 mmHg (Cal.) |
| Flash point | 171.378°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2,5-Dimethoxyphenyl)Methyl]Propanedioic Acid |