Online Database of Chemicals from Around the World
|
CAS#: 72058-41-4 Product: 4,6-Dichloro-N-(2,4,4-Trimethylpentan-2-Yl)-1,3,5-Triazin-2-Amine No suppilers available for the product. |
| Name | 4,6-Dichloro-N-(2,4,4-Trimethylpentan-2-Yl)-1,3,5-Triazin-2-Amine |
|---|---|
| Synonyms | 4,6-Dichloro-N-(1,1,3,3-Tetramethylbutyl)-1,3,5-Triazin-2-Amine; (4,6-Dichloro-S-Triazin-2-Yl)-(1,1,3,3-Tetramethylbutyl)Amine; (4,6-Dichloro-[1,3,5]Triazin-2-Yl)-(1,1,3,3-Tetramethyl-Butyl)-Amine |
| Molecular Structure |  |
| Molecular Formula | C11H18Cl2N4 |
| Molecular Weight | 277.20 |
| CAS Registry Number | 72058-41-4 |
| EINECS | 276-309-1 |
| SMILES | C(C(NC1=NC(=NC(=N1)Cl)Cl)(C)C)C(C)(C)C |
| InChI | 1S/C11H18Cl2N4/c1-10(2,3)6-11(4,5)17-9-15-7(12)14-8(13)16-9/h6H2,1-5H3,(H,14,15,16,17) |
| InChIKey | HPFWYRKGZUGGPB-UHFFFAOYSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.024°C at 760 mmHg (Cal.) |
| Flash point | 192.704°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dichloro-N-(2,4,4-Trimethylpentan-2-Yl)-1,3,5-Triazin-2-Amine |