Online Database of Chemicals from Around the World
|
CAS#: 7210-71-1 Product: 3,6-Dichloro-2,5-Dimethoxy-4-Benzoquinone No suppilers available for the product. |
| Name | 3,6-Dichloro-2,5-Dimethoxy-4-Benzoquinone |
|---|---|
| Synonyms | 2,5-Dichloro-3,6-Dimethoxy-1,4-Benzoquinone; 2,5-Dichloro-3,6-Dimethoxy-P-Benzoquinone; 2,5-Dichloro-3,6-Dimethoxy-Cyclohexa-2,5-Diene-1,4-Dione |
| Molecular Structure |  |
| Molecular Formula | C8H6Cl2O4 |
| Molecular Weight | 237.04 |
| CAS Registry Number | 7210-71-1 |
| SMILES | COC1=C(Cl)C(=O)C(=C(Cl)C1=O)OC |
| InChI | 1S/C8H6Cl2O4/c1-13-7-3(9)6(12)8(14-2)4(10)5(7)11/h1-2H3 |
| InChIKey | JQVAMWPWHPTLNU-UHFFFAOYSA-N |
| Density | 1.496g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.916°C at 760 mmHg (Cal.) |
| Flash point | 186.534°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6-Dichloro-2,5-Dimethoxy-4-Benzoquinone |