Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | (1-Nitroethyl)Benzene |
|---|---|
| Synonyms | 1-Nitro-1-Phenylethane; Benzene, (1-Nitroethyl)-; (1-Nitroethyl)Benzene |
| Molecular Structure |  |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 |
| CAS Registry Number | 7214-61-1 |
| SMILES | C1=C(C([N+](=O)[O-])C)C=CC=C1 |
| InChI | 1S/C8H9NO2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | GJOVHPKYFFGKCY-UHFFFAOYSA-N |
| Density | 1.113g/cm3 (Cal.) |
|---|---|
| Boiling point | 227.997°C at 760 mmHg (Cal.) |
| Flash point | 93.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Nitroethyl)Benzene |